C23H24O11S — CID 174245694
methyl 7-[(2S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4-formyl-1-benzothiophene-2-carboxylate (PubChem CID 174245694) has the molecular formula C23H24O11S and a molecular weight of 508.50 g/mol. Its IUPAC name is methyl 7-[(2S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4-formyl-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 7-[(2S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4-formyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 174245694 |
| Molecular Formula | C23H24O11S |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | methyl 7-[(2S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4-formyl-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(C=O)ccc(O[C@H]3CC(OC(C)=O)C(OC(C)=O)[C@@H](COC(C)=O)O3)c2s1 |
| InChI | InChI=1S/C23H24O11S/c1-11(25)30-10-18-21(32-13(3)27)17(31-12(2)26)8-20(34-18)33-16-6-5-14(9-24)15-7-19(23(28)29-4)35-22(15)16/h5-7,9,17-18,20-21H,8,10H2,1-4H3/t17?,18-,20-,21?/m1/s1 |
| InChIKey | KPVLKDQVOKQQSN-WNKNEZEQSA-N |
| XLogP | 2.42 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|