C30H39N5O13 — CID 174244807
[(4R,6S)-3,4-diacetyloxy-6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxymethylcarbamoyl]-4-formyl-1-methylindol-7-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 174244807) has the molecular formula C30H39N5O13 and a molecular weight of 677.66 g/mol. Its IUPAC name is [(4R,6S)-3,4-diacetyloxy-6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxymethylcarbamoyl]-4-formyl-1-methylindol-7-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(4R,6S)-3,4-diacetyloxy-6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxymethylcarbamoyl]-4-formyl-1-methylindol-7-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 174244807 |
| Molecular Formula | C30H39N5O13 |
| Molecular Weight | 677.66 g/mol |
| Exact Mass | 677.25 |
| IUPAC Name | [(4R,6S)-3,4-diacetyloxy-6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxymethylcarbamoyl]-4-formyl-1-methylindol-7-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Oc2ccc(C=O)c3cc(C(=O)NCOCCOCCOCCN=[N+]=[N-])n(C)c23)C[C@@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C30H39N5O13/c1-18(37)44-16-26-29(46-20(3)39)25(45-19(2)38)14-27(48-26)47-24-6-5-21(15-36)22-13-23(35(4)28(22)24)30(40)32-17-43-12-11-42-10-9-41-8-7-33-34-31/h5-6,13,15,25-27,29H,7-12,14,16-17H2,1-4H3,(H,32,40)/t25-,26?,27-,29?/m1/s1 |
| InChIKey | IFKGGRZUNMFTKK-VKICNKBPSA-N |
| XLogP | 1.96 |
| TPSA | 224.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.66 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|