C30H41N3O15 — CID 165001445
[(2S,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]butanoyl]-2-hydroxyphenoxy]oxan-2-yl]methyl acetate (PubChem CID 165001445) has the molecular formula C30H41N3O15 and a molecular weight of 683.66 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]butanoyl]-2-hydroxyphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]butanoyl]-2-hydroxyphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 165001445 |
| Molecular Formula | C30H41N3O15 |
| Molecular Weight | 683.66 g/mol |
| Exact Mass | 683.25 |
| IUPAC Name | [(2S,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]butanoyl]-2-hydroxyphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OC(Oc2ccc(C(=O)CCCOCCOCCOCCN=[N+]=[N-])cc2O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H41N3O15/c1-18(34)43-17-26-27(44-19(2)35)28(45-20(3)36)29(46-21(4)37)30(48-26)47-25-8-7-22(16-24(25)39)23(38)6-5-10-40-12-14-42-15-13-41-11-9-32-33-31/h7-8,16,26-30,39H,5-6,9-15,17H2,1-4H3/t26-,27+,28+,29-,30?/m0/s1 |
| InChIKey | ZRDLANKMXZQIOH-PTQLTHBBSA-N |
| XLogP | 2.18 |
| TPSA | 237.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|