C28H32N4O11 — CID 122587871
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(3-azidopropylcarbamoyl)naphthalen-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 122587871) has the molecular formula C28H32N4O11 and a molecular weight of 600.58 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(3-azidopropylcarbamoyl)naphthalen-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(3-azidopropylcarbamoyl)naphthalen-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122587871 |
| Molecular Formula | C28H32N4O11 |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(3-azidopropylcarbamoyl)naphthalen-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc3cc(C(=O)NCCCN=[N+]=[N-])ccc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H32N4O11/c1-15(33)38-14-23-24(39-16(2)34)25(40-17(3)35)26(41-18(4)36)28(43-23)42-22-9-8-19-12-21(7-6-20(19)13-22)27(37)30-10-5-11-31-32-29/h6-9,12-13,23-26,28H,5,10-11,14H2,1-4H3,(H,30,37)/t23-,24+,25+,26-,28-/m1/s1 |
| InChIKey | BXKYDQHJHUUIQS-BZTMQRDQSA-N |
| XLogP | 2.73 |
| TPSA | 201.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|