C30H42N2O15 — CID 163639341
[(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-[2-hydroxy-4-[2-[2-[2-[2-(methylideneamino)ethoxy]ethoxy]ethoxy]ethylcarbamoyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 163639341) has the molecular formula C30H42N2O15 and a molecular weight of 670.66 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-[2-hydroxy-4-[2-[2-[2-[2-(methylideneamino)ethoxy]ethoxy]ethoxy]ethylcarbamoyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-[2-hydroxy-4-[2-[2-[2-[2-(methylideneamino)ethoxy]ethoxy]ethoxy]ethylcarbamoyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163639341 |
| Molecular Formula | C30H42N2O15 |
| Molecular Weight | 670.66 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-[2-hydroxy-4-[2-[2-[2-[2-(methylideneamino)ethoxy]ethoxy]ethoxy]ethylcarbamoyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | C=NCCOCCOCCOCCNC(=O)c1ccc(OC2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(O)c1 |
| InChI | InChI=1S/C30H42N2O15/c1-18(33)42-17-25-26(43-19(2)34)27(44-20(3)35)28(45-21(4)36)30(47-25)46-24-7-6-22(16-23(24)37)29(38)32-9-11-40-13-15-41-14-12-39-10-8-31-5/h6-7,16,25-28,30,37H,5,8-15,17H2,1-4H3,(H,32,38)/t25-,26+,27+,28-,30?/m1/s1 |
| InChIKey | ICVVCEQRXHNMGM-GXWURSAASA-N |
| XLogP | 0.33 |
| TPSA | 213.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.66 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|