C28H36N4O13 — CID 166891825
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropyl]-2-formylphenoxy]oxan-2-yl]methyl acetate (PubChem CID 166891825) has the molecular formula C28H36N4O13 and a molecular weight of 636.61 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropyl]-2-formylphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropyl]-2-formylphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 166891825 |
| Molecular Formula | C28H36N4O13 |
| Molecular Weight | 636.61 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropyl]-2-formylphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(CCC(=O)NCCOCCN=[N+]=[N-])cc2C=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H36N4O13/c1-16(34)40-15-23-25(41-17(2)35)26(42-18(3)36)27(43-19(4)37)28(45-23)44-22-7-5-20(13-21(22)14-33)6-8-24(38)30-9-11-39-12-10-31-32-29/h5,7,13-14,23,25-28H,6,8-12,15H2,1-4H3,(H,30,38)/t23-,25+,26+,27-,28-/m1/s1 |
| InChIKey | SHXVUGVPKMZPIO-FWZZJMFBSA-N |
| XLogP | 1.34 |
| TPSA | 227.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.61 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|