C28H39FN4O15S — CID 162505313
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-S-fluorosulfonimidoyl]oxyphenoxy]oxan-2-yl]methyl acetate (PubChem CID 162505313) has the molecular formula C28H39FN4O15S and a molecular weight of 722.70 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-S-fluorosulfonimidoyl]oxyphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-S-fluorosulfonimidoyl]oxyphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162505313 |
| Molecular Formula | C28H39FN4O15S |
| Molecular Weight | 722.70 g/mol |
| Exact Mass | 722.21 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-S-fluorosulfonimidoyl]oxyphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccccc2OS(=O)(F)=NCCOCCOCCOCCN=[N+]=[N-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H39FN4O15S/c1-18(34)42-17-24-25(43-19(2)35)26(44-20(3)36)27(45-21(4)37)28(47-24)46-22-7-5-6-8-23(22)48-49(29,38)32-10-12-40-14-16-41-15-13-39-11-9-31-33-30/h5-8,24-28H,9-17H2,1-4H3/t24-,25+,26+,27-,28-,49?/m1/s1 |
| InChIKey | DSXBGLKRTYTLIT-ZFKJCUFZSA-N |
| XLogP | 2.15 |
| TPSA | 238.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.70 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|