C20H23F2NO11S — CID 154977845
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[difluoro(oxo)-λ6-sulfanylidene]amino]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 154977845) has the molecular formula C20H23F2NO11S and a molecular weight of 523.46 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[difluoro(oxo)-λ6-sulfanylidene]amino]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[difluoro(oxo)-λ6-sulfanylidene]amino]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 154977845 |
| Molecular Formula | C20H23F2NO11S |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[difluoro(oxo)-λ6-sulfanylidene]amino]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccccc2N=S(=O)(F)F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H23F2NO11S/c1-10(24)29-9-16-17(30-11(2)25)18(31-12(3)26)19(32-13(4)27)20(34-16)33-15-8-6-5-7-14(15)23-35(21,22)28/h5-8,16-20H,9H2,1-4H3/t16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | UTKSXMIQQGJNOO-LCWAXJCOSA-N |
| XLogP | 2.02 |
| TPSA | 153.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|