C34H42BrNO16S — CID 165100053
[(2R,3S,4S,5S)-3,4,5-triacetyloxy-6-[2-[4-(bromomethyl)phenoxy]sulfonyloxy-4-(2-butoxyethylcarbamoyl)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 165100053) has the molecular formula C34H42BrNO16S and a molecular weight of 832.67 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-3,4,5-triacetyloxy-6-[2-[4-(bromomethyl)phenoxy]sulfonyloxy-4-(2-butoxyethylcarbamoyl)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5S)-3,4,5-triacetyloxy-6-[2-[4-(bromomethyl)phenoxy]sulfonyloxy-4-(2-butoxyethylcarbamoyl)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 165100053 |
| Molecular Formula | C34H42BrNO16S |
| Molecular Weight | 832.67 g/mol |
| Exact Mass | 831.14 |
| IUPAC Name | [(2R,3S,4S,5S)-3,4,5-triacetyloxy-6-[2-[4-(bromomethyl)phenoxy]sulfonyloxy-4-(2-butoxyethylcarbamoyl)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CCCCOCCNC(=O)c1ccc(OC2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)c(OS(=O)(=O)Oc2ccc(CBr)cc2)c1 |
| InChI | InChI=1S/C34H42BrNO16S/c1-6-7-15-44-16-14-36-33(41)25-10-13-27(28(17-25)52-53(42,43)51-26-11-8-24(18-35)9-12-26)49-34-32(48-23(5)40)31(47-22(4)39)30(46-21(3)38)29(50-34)19-45-20(2)37/h8-13,17,29-32,34H,6-7,14-16,18-19H2,1-5H3,(H,36,41)/t29-,30+,31+,32+,34?/m1/s1 |
| InChIKey | NUNDWCPLYWRVOD-ANTUIUBZSA-N |
| XLogP | 3.29 |
| TPSA | 214.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|