C19H22O10S — CID 145416141
[3,4-diacetyloxy-6-(4-formyl-2-hydroxysulfanylphenoxy)oxan-2-yl]methyl acetate (PubChem CID 145416141) has the molecular formula C19H22O10S and a molecular weight of 442.44 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-(4-formyl-2-hydroxysulfanylphenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-(4-formyl-2-hydroxysulfanylphenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145416141 |
| Molecular Formula | C19H22O10S |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | [3,4-diacetyloxy-6-(4-formyl-2-hydroxysulfanylphenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc(C=O)cc2SO)CC(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H22O10S/c1-10(21)25-9-16-19(27-12(3)23)15(26-11(2)22)7-18(29-16)28-14-5-4-13(8-20)6-17(14)30-24/h4-6,8,15-16,18-19,24H,7,9H2,1-3H3 |
| InChIKey | FRGGBIYXVWPDHQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|