C22H24O10 — CID 167510866
[(2R,3R,4R,6S)-3,4-diacetyloxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 167510866) has the molecular formula C22H24O10 and a molecular weight of 448.42 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-3,4-diacetyloxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167510866 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc3c(C)cc(=O)oc3c2)C[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H24O10/c1-11-7-20(26)31-17-8-15(5-6-16(11)17)30-21-9-18(28-13(3)24)22(29-14(4)25)19(32-21)10-27-12(2)23/h5-8,18-19,21-22H,9-10H2,1-4H3/t18-,19-,21-,22-/m1/s1 |
| InChIKey | GFBZTZBLCNUGDX-UGESXGAOSA-N |
| XLogP | 2.02 |
| TPSA | 127.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|