C28H38N2O12 — CID 16681539
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(8-anilino-8-oxooctanoyl)amino]oxyoxan-2-yl]methyl acetate (PubChem CID 16681539) has the molecular formula C28H38N2O12 and a molecular weight of 594.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(8-anilino-8-oxooctanoyl)amino]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(8-anilino-8-oxooctanoyl)amino]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 16681539 |
| Molecular Formula | C28H38N2O12 |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(8-anilino-8-oxooctanoyl)amino]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](ONC(=O)CCCCCCC(=O)Nc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H38N2O12/c1-17(31)37-16-22-25(38-18(2)32)26(39-19(3)33)27(40-20(4)34)28(41-22)42-30-24(36)15-11-6-5-10-14-23(35)29-21-12-8-7-9-13-21/h7-9,12-13,22,25-28H,5-6,10-11,14-16H2,1-4H3,(H,29,35)(H,30,36)/t22-,25-,26+,27-,28+/m1/s1 |
| InChIKey | VISVVKFZYLIOLL-WZJDRPDSSA-N |
| XLogP | 2.10 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|