C21H19FN6O9 — CID 22869891
[(3S,4R,5R)-4-acetyloxy-5-(acetyloxymethyl)-2-[(2-fluoro-7H-purin-6-yl)amino]oxolan-3-yl] 4-nitrobenzoate (PubChem CID 22869891) has the molecular formula C21H19FN6O9 and a molecular weight of 518.41 g/mol. Its IUPAC name is [(3S,4R,5R)-4-acetyloxy-5-(acetyloxymethyl)-2-[(2-fluoro-7H-purin-6-yl)amino]oxolan-3-yl] 4-nitrobenzoate.
| Compound Name | [(3S,4R,5R)-4-acetyloxy-5-(acetyloxymethyl)-2-[(2-fluoro-7H-purin-6-yl)amino]oxolan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 22869891 |
| Molecular Formula | C21H19FN6O9 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | [(3S,4R,5R)-4-acetyloxy-5-(acetyloxymethyl)-2-[(2-fluoro-7H-purin-6-yl)amino]oxolan-3-yl] 4-nitrobenzoate |
| SMILES | CC(=O)OC[C@H]1OC(Nc2nc(F)nc3nc[nH]c23)[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H19FN6O9/c1-9(29)34-7-13-15(35-10(2)30)16(37-20(31)11-3-5-12(6-4-11)28(32)33)19(36-13)25-18-14-17(24-8-23-14)26-21(22)27-18/h3-6,8,13,15-16,19H,7H2,1-2H3,(H2,23,24,25,26,27)/t13-,15-,16+,19?/m1/s1 |
| InChIKey | UPCCMRXSTHNOBR-QJCNXMQDSA-N |
| XLogP | 1.26 |
| TPSA | 197.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|