C19H25N5O8 — CID 177270370
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-(dimethylamino)-3-methyl-6-oxopurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 177270370) has the molecular formula C19H25N5O8 and a molecular weight of 451.44 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-(dimethylamino)-3-methyl-6-oxopurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-(dimethylamino)-3-methyl-6-oxopurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 177270370 |
| Molecular Formula | C19H25N5O8 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-(dimethylamino)-3-methyl-6-oxopurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(=O)nc(N(C)C)n(C)c32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H25N5O8/c1-9(25)29-7-12-14(30-10(2)26)15(31-11(3)27)18(32-12)24-8-20-13-16(28)21-19(22(4)5)23(6)17(13)24/h8,12,14-15,18H,7H2,1-6H3/t12-,14-,15-,18-/m1/s1 |
| InChIKey | WEFIQEDPQIOKMR-SCFUHWHPSA-N |
| XLogP | -0.48 |
| TPSA | 144.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|