C16H20N4O9 — CID 11531680
[(2R,3R,4S,5S)-1-acetyl-3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)pyrrolidin-2-yl]methyl acetate (PubChem CID 11531680) has the molecular formula C16H20N4O9 and a molecular weight of 412.36 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-1-acetyl-3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)pyrrolidin-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-1-acetyl-3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)pyrrolidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11531680 |
| Molecular Formula | C16H20N4O9 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [(2R,3R,4S,5S)-1-acetyl-3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)pyrrolidin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](n2ncc(=O)[nH]c2=O)N1C(C)=O |
| InChI | InChI=1S/C16H20N4O9/c1-7(21)19-11(6-27-8(2)22)13(28-9(3)23)14(29-10(4)24)15(19)20-16(26)18-12(25)5-17-20/h5,11,13-15H,6H2,1-4H3,(H,18,25,26)/t11-,13-,14-,15+/m1/s1 |
| InChIKey | ZYWDAEFNLKPYKZ-NGFQHRJXSA-N |
| XLogP | -1.91 |
| TPSA | 166.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|