C11H13N3O8S — CID 87408819
[(2R,3R,4R,5R)-5-(5-cyano-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 87408819) has the molecular formula C11H13N3O8S and a molecular weight of 347.31 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(5-cyano-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-5-(5-cyano-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 87408819 |
| Molecular Formula | C11H13N3O8S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(5-cyano-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@@H](O)[C@H](n2cc(C#N)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C11H13N3O8S/c1-23(19,20)22-8-6(4-15)21-10(7(8)16)14-3-5(2-12)9(17)13-11(14)18/h3,6-8,10,15-16H,4H2,1H3,(H,13,17,18)/t6-,7-,8+,10-/m1/s1 |
| InChIKey | BTZQEKPEHKJZBQ-BDNRQGISSA-N |
| XLogP | -3.00 |
| TPSA | 171.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|