C15H20N2O6 — CID 68840069
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hex-1-ynylpyrimidine-2,4-dione (PubChem CID 68840069) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hex-1-ynylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hex-1-ynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 68840069 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hex-1-ynylpyrimidine-2,4-dione |
| SMILES | CCCCC#Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H20N2O6/c1-2-3-4-5-6-9-7-17(15(22)16-13(9)21)14-12(20)11(19)10(8-18)23-14/h7,10-12,14,18-20H,2-4,8H2,1H3,(H,16,21,22)/t10-,11-,12-,14-/m1/s1 |
| InChIKey | FSQCFXOHKHVTPV-HKUMRIAESA-N |
| XLogP | -1.31 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|