C17H20N2O6 — CID 175676884
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-octa-1,7-diynylpyrimidine-2,4-dione (PubChem CID 175676884) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-octa-1,7-diynylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-octa-1,7-diynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175676884 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-octa-1,7-diynylpyrimidine-2,4-dione |
| SMILES | C#CCCCCC#Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H20N2O6/c1-2-3-4-5-6-7-8-11-9-19(17(24)18-15(11)23)16-14(22)13(21)12(10-20)25-16/h1,9,12-14,16,20-22H,3-6,10H2,(H,18,23,24)/t12-,13-,14-,16-/m1/s1 |
| InChIKey | XULBJIWQTNYTNG-IXYNUQLISA-N |
| XLogP | -1.31 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|