C14H20N2O6Si — CID 140734879
1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-trimethylsilyl(1,2-13C2)ethynyl)pyrimidine-2,4-dione (PubChem CID 140734879) has the molecular formula C14H20N2O6Si and a molecular weight of 342.39 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-trimethylsilyl(1,2-13C2)ethynyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-trimethylsilyl(1,2-13C2)ethynyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140734879 |
| Molecular Formula | C14H20N2O6Si |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-trimethylsilyl(1,2-13C2)ethynyl)pyrimidine-2,4-dione |
| SMILES | C[Si](C)(C)[13C]#[13C]c1cn([C@@H]2O[C@H](CO)[C@H](O)[C@@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H20N2O6Si/c1-23(2,3)5-4-8-6-16(14(21)15-12(8)20)13-11(19)10(18)9(7-17)22-13/h6,9-11,13,17-19H,7H2,1-3H3,(H,15,20,21)/t9-,10+,11+,13-/m1/s1/i4+1,5+1 |
| InChIKey | QWIPJBIGVRYXIM-YOFKOLLZSA-N |
| XLogP | -1.62 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|