C16H20N2O3 — CID 102145871
5-hex-1-ynyl-1-[(1R,5S)-5-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-2,4-dione (PubChem CID 102145871) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-hex-1-ynyl-1-[(1R,5S)-5-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-2,4-dione.
| Compound Name | 5-hex-1-ynyl-1-[(1R,5S)-5-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102145871 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 5-hex-1-ynyl-1-[(1R,5S)-5-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidine-2,4-dione |
| SMILES | CCCCC#Cc1cn([C@@H]2C=CC[C@@H]2CO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H20N2O3/c1-2-3-4-5-7-12-10-18(16(21)17-15(12)20)14-9-6-8-13(14)11-19/h6,9-10,13-14,19H,2-4,8,11H2,1H3,(H,17,20,21)/t13-,14-/m1/s1 |
| InChIKey | FKQBAPZSLHKTCV-ZIAGYGMSSA-N |
| XLogP | 1.19 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|