C23H38N2O5Sn — CID 11295678
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-tributylstannylethynyl)pyrimidine-2,4-dione (PubChem CID 11295678) has the molecular formula C23H38N2O5Sn and a molecular weight of 541.28 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-tributylstannylethynyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-tributylstannylethynyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11295678 |
| Molecular Formula | C23H38N2O5Sn |
| Molecular Weight | 541.28 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-tributylstannylethynyl)pyrimidine-2,4-dione |
| SMILES | CCCC[Sn](C#Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O)(CCCC)CCCC |
| InChI | InChI=1S/C11H11N2O5.3C4H9.Sn/c1-2-6-4-13(11(17)12-10(6)16)9-3-7(15)8(5-14)18-9;3*1-3-4-2;/h4,7-9,14-15H,3,5H2,(H,12,16,17);3*1,3-4H2,2H3;/t7-,8+,9+;;;;/m0..../s1 |
| InChIKey | XSGJIMUZIGIJGY-OLTRZSQBSA-N |
| XLogP | 2.92 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|