C10H13ClN2O8S — CID 87409732
[(2R,3R,4R,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 87409732) has the molecular formula C10H13ClN2O8S and a molecular weight of 356.74 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 87409732 |
| Molecular Formula | C10H13ClN2O8S |
| Molecular Weight | 356.74 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@@H](O)[C@H](n2cc(Cl)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C10H13ClN2O8S/c1-22(18,19)21-7-5(3-14)20-9(6(7)15)13-2-4(11)8(16)12-10(13)17/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)/t5-,6-,7+,9-/m1/s1 |
| InChIKey | ORLALANPHMGJMA-JAGXHNFQSA-N |
| XLogP | -2.21 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.74 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|