C11H15N3O6 — CID 3093507
2-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazine-3,5-dione (PubChem CID 3093507) has the molecular formula C11H15N3O6 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 3093507 |
| Molecular Formula | C11H15N3O6 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazine-3,5-dione |
| SMILES | CC1(C)OC2C(CO)OC(n3ncc(=O)[nH]c3=O)C2O1 |
| InChI | InChI=1S/C11H15N3O6/c1-11(2)19-7-5(4-15)18-9(8(7)20-11)14-10(17)13-6(16)3-12-14/h3,5,7-9,15H,4H2,1-2H3,(H,13,16,17) |
| InChIKey | KLPUNNJFJARPLZ-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |