C13H19N3O6 — CID 70908086
1-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(methylamino)pyrimidine-2,4-dione (PubChem CID 70908086) has the molecular formula C13H19N3O6 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(methylamino)pyrimidine-2,4-dione.
| Compound Name | 1-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(methylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70908086 |
| Molecular Formula | C13H19N3O6 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(methylamino)pyrimidine-2,4-dione |
| SMILES | CNc1cc(=O)[nH]c(=O)n1[C@@H]1O[C@H](CO)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C13H19N3O6/c1-13(2)21-9-6(5-17)20-11(10(9)22-13)16-7(14-3)4-8(18)15-12(16)19/h4,6,9-11,14,17H,5H2,1-3H3,(H,15,18,19)/t6-,9?,10?,11-/m1/s1 |
| InChIKey | ULALEOXAKKDGJW-XLMFWOJCSA-N |
| XLogP | -1.01 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |