C12H14N2O6 — CID 14606217
(1R,10R,11R,15R)-13,13-dimethyl-8,12,14,16-tetraoxa-2,4-diazatetracyclo[8.5.1.02,7.011,15]hexadec-6-ene-3,5-dione (PubChem CID 14606217) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is (1R,10R,11R,15R)-13,13-dimethyl-8,12,14,16-tetraoxa-2,4-diazatetracyclo[8.5.1.02,7.011,15]hexadec-6-ene-3,5-dione.
| Compound Name | (1R,10R,11R,15R)-13,13-dimethyl-8,12,14,16-tetraoxa-2,4-diazatetracyclo[8.5.1.02,7.011,15]hexadec-6-ene-3,5-dione |
|---|---|
| PubChem CID | 14606217 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (1R,10R,11R,15R)-13,13-dimethyl-8,12,14,16-tetraoxa-2,4-diazatetracyclo[8.5.1.02,7.011,15]hexadec-6-ene-3,5-dione |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1COc3cc(=O)[nH]c(=O)n3[C@@H]2O1 |
| InChI | InChI=1S/C12H14N2O6/c1-12(2)19-8-5-4-17-7-3-6(15)13-11(16)14(7)10(18-5)9(8)20-12/h3,5,8-10H,4H2,1-2H3,(H,13,15,16)/t5-,8-,9-,10-/m1/s1 |
| InChIKey | LZMBVYPIMDBHIX-UUOKUNOPSA-N |
| XLogP | -0.65 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |