C24H40N2O6Sn — CID 44549704
(1R,10R,11R,15R)-13,13-dimethyl-6-tributylstannyl-8,12,14,16-tetraoxa-2,4-diazatetracyclo[8.5.1.02,7.011,15]hexadec-6-ene-3,5-dione (PubChem CID 44549704) has the molecular formula C24H40N2O6Sn and a molecular weight of 571.30 g/mol. Its IUPAC name is (1R,10R,11R,15R)-13,13-dimethyl-6-tributylstannyl-8,12,14,16-tetraoxa-2,4-diazatetracyclo[8.5.1.02,7.011,15]hexadec-6-ene-3,5-dione.
| Compound Name | (1R,10R,11R,15R)-13,13-dimethyl-6-tributylstannyl-8,12,14,16-tetraoxa-2,4-diazatetracyclo[8.5.1.02,7.011,15]hexadec-6-ene-3,5-dione |
|---|---|
| PubChem CID | 44549704 |
| Molecular Formula | C24H40N2O6Sn |
| Molecular Weight | 571.30 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | (1R,10R,11R,15R)-13,13-dimethyl-6-tributylstannyl-8,12,14,16-tetraoxa-2,4-diazatetracyclo[8.5.1.02,7.011,15]hexadec-6-ene-3,5-dione |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1c2n(c(=O)[nH]c1=O)[C@@H]1O[C@H](CO2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C12H13N2O6.3C4H9.Sn/c1-12(2)19-8-5-4-17-7-3-6(15)13-11(16)14(7)10(18-5)9(8)20-12;3*1-3-4-2;/h5,8-10H,4H2,1-2H3,(H,13,15,16);3*1,3-4H2,2H3;/t5-,8-,9-,10-;;;;/m1..../s1 |
| InChIKey | UJGMJDITRDOZQW-YXSCOWGUSA-N |
| XLogP | 3.40 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |