C12H14ClIN2O5 — CID 163199631
1-[(3aS,6S)-6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-chloropyrimidine-2,4-dione (PubChem CID 163199631) has the molecular formula C12H14ClIN2O5 and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-[(3aS,6S)-6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-chloropyrimidine-2,4-dione.
| Compound Name | 1-[(3aS,6S)-6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-chloropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163199631 |
| Molecular Formula | C12H14ClIN2O5 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | 1-[(3aS,6S)-6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-chloropyrimidine-2,4-dione |
| SMILES | CC1(C)OC2[C@H](O1)C(n1cc(Cl)c(=O)[nH]c1=O)O[C@@H]2CI |
| InChI | InChI=1S/C12H14ClIN2O5/c1-12(2)20-7-6(3-14)19-10(8(7)21-12)16-4-5(13)9(17)15-11(16)18/h4,6-8,10H,3H2,1-2H3,(H,15,17,18)/t6-,7?,8+,10?/m1/s1 |
| InChIKey | JBIGXEKNXBLQOR-YQXFOVADSA-N |
| XLogP | 1.04 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|