C17H22N3O8P — CID 10788591
3-[[(1R,13R,14R,18R)-16,16-dimethyl-3,5-dioxo-9,11,15,17,19-pentaoxa-2,4-diaza-10-phosphatetracyclo[11.5.1.12,6.014,18]icos-6(20)-en-10-yl]oxy]propanenitrile (PubChem CID 10788591) has the molecular formula C17H22N3O8P and a molecular weight of 427.35 g/mol. Its IUPAC name is 3-[[(1R,13R,14R,18R)-16,16-dimethyl-3,5-dioxo-9,11,15,17,19-pentaoxa-2,4-diaza-10-phosphatetracyclo[11.5.1.12,6.014,18]icos-6(20)-en-10-yl]oxy]propanenitrile.
| Compound Name | 3-[[(1R,13R,14R,18R)-16,16-dimethyl-3,5-dioxo-9,11,15,17,19-pentaoxa-2,4-diaza-10-phosphatetracyclo[11.5.1.12,6.014,18]icos-6(20)-en-10-yl]oxy]propanenitrile |
|---|---|
| PubChem CID | 10788591 |
| Molecular Formula | C17H22N3O8P |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 3-[[(1R,13R,14R,18R)-16,16-dimethyl-3,5-dioxo-9,11,15,17,19-pentaoxa-2,4-diaza-10-phosphatetracyclo[11.5.1.12,6.014,18]icos-6(20)-en-10-yl]oxy]propanenitrile |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1COP(OCCC#N)OCCc3cn(c(=O)[nH]c3=O)[C@@H]2O1 |
| InChI | InChI=1S/C17H22N3O8P/c1-17(2)27-12-11-9-25-29(23-6-3-5-18)24-7-4-10-8-20(16(22)19-14(10)21)15(26-11)13(12)28-17/h8,11-13,15H,3-4,6-7,9H2,1-2H3,(H,19,21,22)/t11-,12-,13-,15-,29?/m1/s1 |
| InChIKey | HXXGQOFAJLACHT-ZEUNJUPASA-N |
| XLogP | 0.70 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|