C22H34N2O6Si — CID 10389085
1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5,6-dihydroquinazoline-2,4-dione (PubChem CID 10389085) has the molecular formula C22H34N2O6Si and a molecular weight of 450.61 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5,6-dihydroquinazoline-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5,6-dihydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 10389085 |
| Molecular Formula | C22H34N2O6Si |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5,6-dihydroquinazoline-2,4-dione |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]2n1c2c(c(=O)[nH]c1=O)CCC=C2 |
| InChI | InChI=1S/C22H34N2O6Si/c1-21(2,3)31(6,7)27-12-15-16-17(30-22(4,5)29-16)19(28-15)24-14-11-9-8-10-13(14)18(25)23-20(24)26/h9,11,15-17,19H,8,10,12H2,1-7H3,(H,23,25,26)/t15-,16-,17-,19-/m1/s1 |
| InChIKey | HSULLLDPHDDIGF-YWTNHNAXSA-N |
| XLogP | 2.94 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|