C20H34N2O6Si — CID 10741119
(6E)-1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-ethylidene-1,3-diazinane-2,4-dione (PubChem CID 10741119) has the molecular formula C20H34N2O6Si and a molecular weight of 426.59 g/mol. Its IUPAC name is (6E)-1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-ethylidene-1,3-diazinane-2,4-dione.
| Compound Name | (6E)-1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-ethylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 10741119 |
| Molecular Formula | C20H34N2O6Si |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (6E)-1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-ethylidene-1,3-diazinane-2,4-dione |
| SMILES | C/C=C1\CC(=O)NC(=O)N1[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H34N2O6Si/c1-9-12-10-14(23)21-18(24)22(12)17-16-15(27-20(5,6)28-16)13(26-17)11-25-29(7,8)19(2,3)4/h9,13,15-17H,10-11H2,1-8H3,(H,21,23,24)/b12-9+/t13-,15-,16-,17-/m1/s1 |
| InChIKey | PVWONZXKQLAOIC-XKPWUXJZSA-N |
| XLogP | 3.10 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|