C20H33ClN4O4Si — CID 90703672
7-[(3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 90703672) has the molecular formula C20H33ClN4O4Si and a molecular weight of 457.05 g/mol. Its IUPAC name is 7-[(3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-[(3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 90703672 |
| Molecular Formula | C20H33ClN4O4Si |
| Molecular Weight | 457.05 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 7-[(3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(N3CCc4c(Cl)nc(N)nc43)[C@@H]2O1 |
| InChI | InChI=1S/C20H33ClN4O4Si/c1-19(2,3)30(6,7)26-10-12-13-14(29-20(4,5)28-13)17(27-12)25-9-8-11-15(21)23-18(22)24-16(11)25/h12-14,17H,8-10H2,1-7H3,(H2,22,23,24)/t12-,13-,14-,17?/m1/s1 |
| InChIKey | RRUWFDKPVLHBPJ-OMNQEHGGSA-N |
| XLogP | 3.34 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.05 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|