C12H14N2O5 — CID 11369123
(1R,9R,10R,14R)-12,12-dimethyl-11,13,15-trioxa-2,4-diazatetracyclo[7.5.1.02,7.010,14]pentadec-6-ene-3,5-dione (PubChem CID 11369123) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is (1R,9R,10R,14R)-12,12-dimethyl-11,13,15-trioxa-2,4-diazatetracyclo[7.5.1.02,7.010,14]pentadec-6-ene-3,5-dione.
| Compound Name | (1R,9R,10R,14R)-12,12-dimethyl-11,13,15-trioxa-2,4-diazatetracyclo[7.5.1.02,7.010,14]pentadec-6-ene-3,5-dione |
|---|---|
| PubChem CID | 11369123 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (1R,9R,10R,14R)-12,12-dimethyl-11,13,15-trioxa-2,4-diazatetracyclo[7.5.1.02,7.010,14]pentadec-6-ene-3,5-dione |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1Cc3cc(=O)[nH]c(=O)n3[C@@H]2O1 |
| InChI | InChI=1S/C12H14N2O5/c1-12(2)18-8-6-3-5-4-7(15)13-11(16)14(5)10(17-6)9(8)19-12/h4,6,8-10H,3H2,1-2H3,(H,13,15,16)/t6-,8-,9-,10-/m1/s1 |
| InChIKey | FZLUEKDYKCMBEX-PEBGCTIMSA-N |
| XLogP | -0.49 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |