C22H24N2O7 — CID 11080472
1-[(3aR,4R,6R,6aR)-6-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(2-phenylethynyl)pyrimidine-2,4-dione (PubChem CID 11080472) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(2-phenylethynyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(2-phenylethynyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11080472 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-(methoxymethoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(2-phenylethynyl)pyrimidine-2,4-dione |
| SMILES | COCOC[C@H]1O[C@@H](n2c(C#Cc3ccccc3)cc(=O)[nH]c2=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C22H24N2O7/c1-22(2)30-18-16(12-28-13-27-3)29-20(19(18)31-22)24-15(11-17(25)23-21(24)26)10-9-14-7-5-4-6-8-14/h4-8,11,16,18-20H,12-13H2,1-3H3,(H,23,25,26)/t16-,18-,19-,20-/m1/s1 |
| InChIKey | VQJOGLBOSYUKBD-VBSBHUPXSA-N |
| XLogP | 0.97 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|