C12H16N2O5 — CID 5251322
12,12-dimethyl-11,13,15-trioxa-2,4-diazatetracyclo[7.5.1.02,7.010,14]pentadecane-3,5-dione (PubChem CID 5251322) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 12,12-dimethyl-11,13,15-trioxa-2,4-diazatetracyclo[7.5.1.02,7.010,14]pentadecane-3,5-dione.
| Compound Name | 12,12-dimethyl-11,13,15-trioxa-2,4-diazatetracyclo[7.5.1.02,7.010,14]pentadecane-3,5-dione |
|---|---|
| PubChem CID | 5251322 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 12,12-dimethyl-11,13,15-trioxa-2,4-diazatetracyclo[7.5.1.02,7.010,14]pentadecane-3,5-dione |
| SMILES | CC1(C)OC2C3CC4CC(=O)NC(=O)N4C(O3)C2O1 |
| InChI | InChI=1S/C12H16N2O5/c1-12(2)18-8-6-3-5-4-7(15)13-11(16)14(5)10(17-6)9(8)19-12/h5-6,8-10H,3-4H2,1-2H3,(H,13,15,16) |
| InChIKey | ILXBLWLTCNCYAW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |