C13H17NO6 — CID 101157560
1-[(1R,2S,6R,7S,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]pyrrolidine-2,5-dione (PubChem CID 101157560) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-[(1R,2S,6R,7S,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(1R,2S,6R,7S,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 101157560 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-[(1R,2S,6R,7S,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]pyrrolidine-2,5-dione |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@H]1CO[C@H](O1)[C@H]2N1C(=O)CCC1=O |
| InChI | InChI=1S/C13H17NO6/c1-13(2)19-10-6-5-17-12(18-6)9(11(10)20-13)14-7(15)3-4-8(14)16/h6,9-12H,3-5H2,1-2H3/t6-,9+,10-,11-,12-/m1/s1 |
| InChIKey | QDNOUIWCFKVCHW-YKWXUGINSA-N |
| XLogP | -0.22 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|