C8H12O6S — CID 134986662
(1R,9R)-11,11-dimethyl-3,5,7,10,12-pentaoxa-4λ4-thiatricyclo[7.3.0.02,6]dodecane 4-oxide (PubChem CID 134986662) has the molecular formula C8H12O6S and a molecular weight of 236.24 g/mol. Its IUPAC name is (1R,9R)-11,11-dimethyl-3,5,7,10,12-pentaoxa-4λ4-thiatricyclo[7.3.0.02,6]dodecane 4-oxide.
| Compound Name | (1R,9R)-11,11-dimethyl-3,5,7,10,12-pentaoxa-4λ4-thiatricyclo[7.3.0.02,6]dodecane 4-oxide |
|---|---|
| PubChem CID | 134986662 |
| Molecular Formula | C8H12O6S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (1R,9R)-11,11-dimethyl-3,5,7,10,12-pentaoxa-4λ4-thiatricyclo[7.3.0.02,6]dodecane 4-oxide |
| SMILES | CC1(C)O[C@@H]2COC3OS(=O)OC3[C@@H]2O1 |
| InChI | InChI=1S/C8H12O6S/c1-8(2)11-4-3-10-7-6(5(4)12-8)13-15(9)14-7/h4-7H,3H2,1-2H3/t4-,5-,6?,7?,15?/m1/s1 |
| InChIKey | MCKHCNOOTYNVIK-NYONEBDRSA-N |
| XLogP | -0.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |