C12H19N3O7S — CID 74477124
2-[2,2-dimethyl-6-(methylsulfonylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazinane-3,5-dione (PubChem CID 74477124) has the molecular formula C12H19N3O7S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazinane-3,5-dione.
| Compound Name | 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazinane-3,5-dione |
|---|---|
| PubChem CID | 74477124 |
| Molecular Formula | C12H19N3O7S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazinane-3,5-dione |
| SMILES | CC1(C)OC2C(CS(C)(=O)=O)OC(N3NCC(=O)NC3=O)C2O1 |
| InChI | InChI=1S/C12H19N3O7S/c1-12(2)21-8-6(5-23(3,18)19)20-10(9(8)22-12)15-11(17)14-7(16)4-13-15/h6,8-10,13H,4-5H2,1-3H3,(H,14,16,17) |
| InChIKey | ONPMFOUTBDSCNX-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |