C11H16N4O5 — CID 164541195
5-amino-2-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazin-3-one (PubChem CID 164541195) has the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 5-amino-2-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazin-3-one.
| Compound Name | 5-amino-2-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 164541195 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 5-amino-2-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazin-3-one |
| SMILES | CC1(C)OC2C(O1)[C@@H](CO)O[C@H]2n1ncc(N)nc1=O |
| InChI | InChI=1S/C11H16N4O5/c1-11(2)19-7-5(4-16)18-9(8(7)20-11)15-10(17)14-6(12)3-13-15/h3,5,7-9,16H,4H2,1-2H3,(H2,12,14,17)/t5-,7?,8?,9-/m1/s1 |
| InChIKey | PGLNPIFNVLCNCF-WFXDJJTDSA-N |
| XLogP | -1.37 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |