C8H12N4O4 — CID 174224301
5-amino-2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-1,2,4-triazin-3-one (PubChem CID 174224301) has the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. Its IUPAC name is 5-amino-2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-1,2,4-triazin-3-one.
| Compound Name | 5-amino-2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 174224301 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 5-amino-2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-1,2,4-triazin-3-one |
| SMILES | C[C@H]1O[C@@H](n2ncc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H12N4O4/c1-3-5(13)6(14)7(16-3)12-8(15)11-4(9)2-10-12/h2-3,5-7,13-14H,1H3,(H2,9,11,15)/t3-,5-,6-,7-/m1/s1 |
| InChIKey | NCYMGZANEUDLBG-SHUUEZRQSA-N |
| XLogP | -2.14 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |