C8H13N3O3 — CID 69218256
(3R,4S,5R)-2-(4-aminoimidazol-1-yl)-5-methyloxolane-3,4-diol (PubChem CID 69218256) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is (3R,4S,5R)-2-(4-aminoimidazol-1-yl)-5-methyloxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-(4-aminoimidazol-1-yl)-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 69218256 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (3R,4S,5R)-2-(4-aminoimidazol-1-yl)-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1OC(n2cnc(N)c2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H13N3O3/c1-4-6(12)7(13)8(14-4)11-2-5(9)10-3-11/h2-4,6-8,12-13H,9H2,1H3/t4-,6-,7-,8?/m1/s1 |
| InChIKey | UQLLQLWLKZGJCM-ZRTZXPPTSA-N |
| XLogP | -0.90 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |