C12H16N4O4 — CID 46181794
(2R,3R,4S,5S,6R)-2-methyl-6-(6-methylpurin-9-yl)oxane-3,4,5-triol (PubChem CID 46181794) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-methyl-6-(6-methylpurin-9-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-methyl-6-(6-methylpurin-9-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46181794 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-methyl-6-(6-methylpurin-9-yl)oxane-3,4,5-triol |
| SMILES | Cc1ncnc2c1ncn2[C@@H]1O[C@H](C)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16N4O4/c1-5-7-11(14-3-13-5)16(4-15-7)12-10(19)9(18)8(17)6(2)20-12/h3-4,6,8-10,12,17-19H,1-2H3/t6-,8+,9+,10+,12-/m1/s1 |
| InChIKey | CZCJZKHZQOGBSK-NQRJQWJPSA-N |
| XLogP | -0.87 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |