C15H24N4O3 — CID 160881983
methane;(2R,4S,5R)-2-methyl-5-(6-methyl-2-propylpurin-9-yl)oxolane-3,4-diol (PubChem CID 160881983) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is methane;(2R,4S,5R)-2-methyl-5-(6-methyl-2-propylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | methane;(2R,4S,5R)-2-methyl-5-(6-methyl-2-propylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 160881983 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | methane;(2R,4S,5R)-2-methyl-5-(6-methyl-2-propylpurin-9-yl)oxolane-3,4-diol |
| SMILES | C.CCCc1nc(C)c2ncn([C@@H]3O[C@H](C)C(O)[C@@H]3O)c2n1 |
| InChI | InChI=1S/C14H20N4O3.CH4/c1-4-5-9-16-7(2)10-13(17-9)18(6-15-10)14-12(20)11(19)8(3)21-14;/h6,8,11-12,14,19-20H,4-5H2,1-3H3;1H4/t8-,11?,12+,14-;/m1./s1 |
| InChIKey | SNDQLLUUYDPSIL-FKUOONBXSA-N |
| XLogP | 1.36 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |