C13H12F6N4O4 — CID 53243534
(2R,3R,4R,5R,6S)-2-[2,6-bis(trifluoromethyl)purin-9-yl]-6-methyloxane-3,4,5-triol (PubChem CID 53243534) has the molecular formula C13H12F6N4O4 and a molecular weight of 402.25 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-[2,6-bis(trifluoromethyl)purin-9-yl]-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6S)-2-[2,6-bis(trifluoromethyl)purin-9-yl]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 53243534 |
| Molecular Formula | C13H12F6N4O4 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-[2,6-bis(trifluoromethyl)purin-9-yl]-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](n2cnc3c(C(F)(F)F)nc(C(F)(F)F)nc32)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H12F6N4O4/c1-3-5(24)6(25)7(26)10(27-3)23-2-20-4-8(12(14,15)16)21-11(13(17,18)19)22-9(4)23/h2-3,5-7,10,24-26H,1H3/t3-,5-,6+,7+,10+/m0/s1 |
| InChIKey | DGOZFOLXLMZHBQ-MOQPINPBSA-N |
| XLogP | 0.86 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |