C25H29IN8O6 — CID 158084071
(2R,4R,5R)-2-(2-iodo-6-methylpurin-9-yl)-5-methyloxolane-3,4-diol;(2R,3R,5R)-2-methyl-5-(6-methyl-2-prop-1-ynylpurin-9-yl)oxolane-3,4-diol (PubChem CID 158084071) has the molecular formula C25H29IN8O6 and a molecular weight of 664.46 g/mol. Its IUPAC name is (2R,4R,5R)-2-(2-iodo-6-methylpurin-9-yl)-5-methyloxolane-3,4-diol;(2R,3R,5R)-2-methyl-5-(6-methyl-2-prop-1-ynylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,4R,5R)-2-(2-iodo-6-methylpurin-9-yl)-5-methyloxolane-3,4-diol;(2R,3R,5R)-2-methyl-5-(6-methyl-2-prop-1-ynylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 158084071 |
| Molecular Formula | C25H29IN8O6 |
| Molecular Weight | 664.46 g/mol |
| Exact Mass | 664.13 |
| IUPAC Name | (2R,4R,5R)-2-(2-iodo-6-methylpurin-9-yl)-5-methyloxolane-3,4-diol;(2R,3R,5R)-2-methyl-5-(6-methyl-2-prop-1-ynylpurin-9-yl)oxolane-3,4-diol |
| SMILES | CC#Cc1nc(C)c2ncn([C@@H]3O[C@H](C)[C@H](O)C3O)c2n1.Cc1nc(I)nc2c1ncn2[C@@H]1O[C@H](C)[C@H](O)C1O |
| InChI | InChI=1S/C14H16N4O3.C11H13IN4O3/c1-4-5-9-16-7(2)10-13(17-9)18(6-15-10)14-12(20)11(19)8(3)21-14;1-4-6-9(15-11(12)14-4)16(3-13-6)10-8(18)7(17)5(2)19-10/h6,8,11-12,14,19-20H,1-3H3;3,5,7-8,10,17-18H,1-2H3/t8-,11+,12?,14-;5-,7+,8?,10-/m11/s1 |
| InChIKey | FNHNAJLTAQSPER-XSBNNCFYSA-N |
| XLogP | 0.52 |
| TPSA | 186.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|