C19H19N5O3Y-2 — CID 59936255
2-(6-amino-2-prop-1-ynylpurin-9-yl)-5-methyloxolane-3,4-diol;benzene;yttrium (PubChem CID 59936255) has the molecular formula C19H19N5O3Y-2 and a molecular weight of 454.30 g/mol. Its IUPAC name is 2-(6-amino-2-prop-1-ynylpurin-9-yl)-5-methyloxolane-3,4-diol;benzene;yttrium.
| Compound Name | 2-(6-amino-2-prop-1-ynylpurin-9-yl)-5-methyloxolane-3,4-diol;benzene;yttrium |
|---|---|
| PubChem CID | 59936255 |
| Molecular Formula | C19H19N5O3Y-2 |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-(6-amino-2-prop-1-ynylpurin-9-yl)-5-methyloxolane-3,4-diol;benzene;yttrium |
| SMILES | [CH2-]C#Cc1nc(N)c2ncn(C3OC(C)C(O)C3O)c2n1.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C13H14N5O3.C6H5.Y/c1-3-4-7-16-11(14)8-12(17-7)18(5-15-8)13-10(20)9(19)6(2)21-13;1-2-4-6-5-3-1;/h5-6,9-10,13,19-20H,1H2,2H3,(H2,14,16,17);1-5H;/q2*-1; |
| InChIKey | LWGIRVDOLDTRMD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|