C16H21N5O4 — CID 57393394
(2R,3R,4S,5R)-2-[6-amino-2-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 57393394) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 57393394 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(N)nc(OC4C[C@@H]5C[C@@H]5C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H21N5O4/c1-6-11(22)12(23)15(24-6)21-5-18-10-13(17)19-16(20-14(10)21)25-9-3-7-2-8(7)4-9/h5-9,11-12,15,22-23H,2-4H2,1H3,(H2,17,19,20)/t6-,7-,8+,9?,11-,12-,15-/m1/s1 |
| InChIKey | KHZHERABNDMDHB-PEXRMNMUSA-N |
| XLogP | 0.22 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |