C17H23N5O5 — CID 68935114
(2R,3R,4S,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-5-[(Z)-3-hydroxyprop-1-enyl]oxolane-3,4-diol (PubChem CID 68935114) has the molecular formula C17H23N5O5 and a molecular weight of 377.40 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-5-[(Z)-3-hydroxyprop-1-enyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-5-[(Z)-3-hydroxyprop-1-enyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 68935114 |
| Molecular Formula | C17H23N5O5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-2-cyclopentyloxypurin-9-yl)-5-[(Z)-3-hydroxyprop-1-enyl]oxolane-3,4-diol |
| SMILES | Nc1nc(OC2CCCC2)nc2c1ncn2[C@@H]1O[C@H](/C=C\CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H23N5O5/c18-14-11-15(21-17(20-14)26-9-4-1-2-5-9)22(8-19-11)16-13(25)12(24)10(27-16)6-3-7-23/h3,6,8-10,12-13,16,23-25H,1-2,4-5,7H2,(H2,18,20,21)/b6-3-/t10-,12-,13-,16-/m1/s1 |
| InChIKey | POHGFOFXISMRKH-XOLYJMADSA-N |
| XLogP | -0.10 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|