C15H20BrN5O3 — CID 68933383
(2R,3R,4R,5R)-5-(6-amino-2-cyclopentyloxypurin-9-yl)-4-bromo-2-methyloxolan-3-ol (PubChem CID 68933383) has the molecular formula C15H20BrN5O3 and a molecular weight of 398.26 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-amino-2-cyclopentyloxypurin-9-yl)-4-bromo-2-methyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(6-amino-2-cyclopentyloxypurin-9-yl)-4-bromo-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 68933383 |
| Molecular Formula | C15H20BrN5O3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-amino-2-cyclopentyloxypurin-9-yl)-4-bromo-2-methyloxolan-3-ol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(N)nc(OC4CCCC4)nc32)[C@H](Br)[C@@H]1O |
| InChI | InChI=1S/C15H20BrN5O3/c1-7-11(22)9(16)14(23-7)21-6-18-10-12(17)19-15(20-13(10)21)24-8-4-2-3-5-8/h6-9,11,14,22H,2-5H2,1H3,(H2,17,19,20)/t7-,9-,11-,14-/m1/s1 |
| InChIKey | WOPYBCCJYGULFN-NKNIEXMISA-N |
| XLogP | 1.77 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|