C19H24N6O5 — CID 87629494
2-[(3aR,4R,6R,6aR)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyacetonitrile (PubChem CID 87629494) has the molecular formula C19H24N6O5 and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-[(3aR,4R,6R,6aR)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyacetonitrile.
| Compound Name | 2-[(3aR,4R,6R,6aR)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyacetonitrile |
|---|---|
| PubChem CID | 87629494 |
| Molecular Formula | C19H24N6O5 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-[(3aR,4R,6R,6aR)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyacetonitrile |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(O)C#N)O[C@H]2n1cnc2c(N)nc(OC3CCCC3)nc21 |
| InChI | InChI=1S/C19H24N6O5/c1-19(2)29-13-12(10(26)7-20)28-17(14(13)30-19)25-8-22-11-15(21)23-18(24-16(11)25)27-9-5-3-4-6-9/h8-10,12-14,17,26H,3-6H2,1-2H3,(H2,21,23,24)/t10?,12-,13-,14-,17-/m1/s1 |
| InChIKey | MIEOEUIIBAZMCH-UEEBTXRCSA-N |
| XLogP | 1.03 |
| TPSA | 150.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|