C20H27N5O5S — CID 87627525
S-[[(3aR,4R,6S,6aS)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] ethanethioate (PubChem CID 87627525) has the molecular formula C20H27N5O5S and a molecular weight of 449.53 g/mol. Its IUPAC name is S-[[(3aR,4R,6S,6aS)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] ethanethioate.
| Compound Name | S-[[(3aR,4R,6S,6aS)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 87627525 |
| Molecular Formula | C20H27N5O5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | S-[[(3aR,4R,6S,6aS)-4-(6-amino-2-cyclopentyloxypurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@H]1O[C@@H](n2cnc3c(N)nc(OC4CCCC4)nc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H27N5O5S/c1-10(26)31-8-12-14-15(30-20(2,3)29-14)18(28-12)25-9-22-13-16(21)23-19(24-17(13)25)27-11-6-4-5-7-11/h9,11-12,14-15,18H,4-8H2,1-3H3,(H2,21,23,24)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | ICRTXBUJTPGOKM-SCFUHWHPSA-N |
| XLogP | 2.43 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|